C17H15F5O4S — CID 19004014
[difluoro-(2,3,4-trifluorophenyl)methyl] 4-methoxy-2,3,6-trimethylbenzenesulfonate (PubChem CID 19004014) has the molecular formula C17H15F5O4S and a molecular weight of 410.36 g/mol. Its IUPAC name is [difluoro-(2,3,4-trifluorophenyl)methyl] 4-methoxy-2,3,6-trimethylbenzenesulfonate.
| Compound Name | [difluoro-(2,3,4-trifluorophenyl)methyl] 4-methoxy-2,3,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 19004014 |
| Molecular Formula | C17H15F5O4S |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | [difluoro-(2,3,4-trifluorophenyl)methyl] 4-methoxy-2,3,6-trimethylbenzenesulfonate |
| SMILES | COc1cc(C)c(S(=O)(=O)OC(F)(F)c2ccc(F)c(F)c2F)c(C)c1C |
| InChI | InChI=1S/C17H15F5O4S/c1-8-7-13(25-4)9(2)10(3)16(8)27(23,24)26-17(21,22)11-5-6-12(18)15(20)14(11)19/h5-7H,1-4H3 |
| InChIKey | NRLOEQBOBRDHBN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|