C33H50N6O3 — CID 19004111
2-N-methyl-2-N-[2-(methylamino)ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperazine-1,2,4-tricarboxamide (PubChem CID 19004111) has the molecular formula C33H50N6O3 and a molecular weight of 578.80 g/mol. Its IUPAC name is 2-N-methyl-2-N-[2-(methylamino)ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperazine-1,2,4-tricarboxamide.
| Compound Name | 2-N-methyl-2-N-[2-(methylamino)ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperazine-1,2,4-tricarboxamide |
|---|---|
| PubChem CID | 19004111 |
| Molecular Formula | C33H50N6O3 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.39 |
| IUPAC Name | 2-N-methyl-2-N-[2-(methylamino)ethyl]-4-N,4-N-dipentyl-1-N,1-N-diphenylpiperazine-1,2,4-tricarboxamide |
| SMILES | CCCCCN(CCCCC)C(=O)N1CCN(C(=O)N(c2ccccc2)c2ccccc2)C(C(=O)N(C)CCNC)C1 |
| InChI | InChI=1S/C33H50N6O3/c1-5-7-15-22-36(23-16-8-6-2)32(41)37-25-26-38(30(27-37)31(40)35(4)24-21-34-3)33(42)39(28-17-11-9-12-18-28)29-19-13-10-14-20-29/h9-14,17-20,30,34H,5-8,15-16,21-27H2,1-4H3 |
| InChIKey | YVMYVWZRBUVFAQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|