About 4-N-(3-aminopropyl)cyclohexane-1,4-diamine
4-N-(3-aminopropyl)cyclohexane-1,4-diamine (PubChem CID 19004811) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-(3-aminopropyl)cyclohexane-1,4-diamine |
| PubChem CID | 19004811 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 4-N-(3-aminopropyl)cyclohexane-1,4-diamine |
| SMILES | NCCCNC1CCC(N)CC1 |
| InChI | InChI=1S/C9H21N3/c10-6-1-7-12-9-4-2-8(11)3-5-9/h8-9,12H,1-7,10-11H2 |
| InChIKey | QIMPCSMJRMPRJC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(3-aminopropyl)cyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(3-aminopropyl)cyclohexane-1,4-diamine?
The IUPAC name of 4-N-(3-aminopropyl)cyclohexane-1,4-diamine (CID 19004811) is 4-N-(3-aminopropyl)cyclohexane-1,4-diamine.
What is the SMILES notation for 4-N-(3-aminopropyl)cyclohexane-1,4-diamine?
The canonical SMILES for 4-N-(3-aminopropyl)cyclohexane-1,4-diamine is NCCCNC1CCC(N)CC1.
What is the InChIKey of 4-N-(3-aminopropyl)cyclohexane-1,4-diamine?
The InChIKey is QIMPCSMJRMPRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c10-6-1-7-12-9-4-2-8(11)3-5-9/h8-9,12H,1-7,10-11H2.
What are the key properties of 4-N-(3-aminopropyl)cyclohexane-1,4-diamine?
4-N-(3-aminopropyl)cyclohexane-1,4-diamine has a molecular weight of 171.29 g/mol, XLogP of 0.19, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(3-aminopropyl)cyclohexane-1,4-diamine is sourced from PubChem (CID 19004811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).