C15H11N3O — CID 19004987
3-[2-(4-methylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 19004987) has the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-[2-(4-methylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(4-methylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 19004987 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 3-[2-(4-methylphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(C#Cn2cnc3[nH]ccc3c2=O)cc1 |
| InChI | InChI=1S/C15H11N3O/c1-11-2-4-12(5-3-11)7-9-18-10-17-14-13(15(18)19)6-8-16-14/h2-6,8,10,16H,1H3 |
| InChIKey | JUUJFXSNOWWNSA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|