About zinc carbonate
zinc carbonate (PubChem CID 19005) has the molecular formula CO3Zn
and a molecular weight of 125.40 g/mol. Its IUPAC name is zinc carbonate.
Molecular Properties
| Compound Name | zinc carbonate |
| PubChem CID | 19005 |
| Molecular Formula | CO3Zn |
| Molecular Weight | 125.40 g/mol |
| Exact Mass | 123.91 |
| IUPAC Name | zinc carbonate |
| SMILES | O=C([O-])[O-].[Zn+2] |
| InChI | InChI=1S/CH2O3.Zn/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| InChIKey | FMRLDPWIRHBCCC-UHFFFAOYSA-L |
| XLogP | -2.45 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.40 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc carbonate?
The IUPAC name of zinc carbonate (CID 19005) is zinc carbonate.
What is the SMILES notation for zinc carbonate?
The canonical SMILES for zinc carbonate is O=C([O-])[O-].[Zn+2].
What is the InChIKey of zinc carbonate?
The InChIKey is FMRLDPWIRHBCCC-UHFFFAOYSA-L. The full InChI is InChI=1S/CH2O3.Zn/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2.
What are the key properties of zinc carbonate?
zinc carbonate has a molecular weight of 125.40 g/mol, XLogP of -2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc carbonate is sourced from PubChem (CID 19005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).