About methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium
methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 19005305) has the molecular formula C13H26N2O7S
and a molecular weight of 354.43 g/mol. Its IUPAC name is methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
Molecular Properties
| Compound Name | methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| PubChem CID | 19005305 |
| Molecular Formula | C13H26N2O7S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)C.C=CC(N)=O.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H18NO2.C3H5NO.CH4O4S/c1-8(2)9(11)12-7-6-10(3,4)5;1-2-3(4)5;1-5-6(2,3)4/h1,6-7H2,2-5H3;2H,1H2,(H2,4,5);1H3,(H,2,3,4)/q+1;;/p-1 |
| InChIKey | KDWVVKPUUIKFCO-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 135.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium?
The IUPAC name of methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (CID 19005305) is methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
What is the SMILES notation for methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium?
The canonical SMILES for methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium is C=C(C)C(=O)OCC[N+](C)(C)C.C=CC(N)=O.COS(=O)(=O)[O-].
What is the InChIKey of methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium?
The InChIKey is KDWVVKPUUIKFCO-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18NO2.C3H5NO.CH4O4S/c1-8(2)9(11)12-7-6-10(3,4)5;1-2-3(4)5;1-5-6(2,3)4/h1,6-7H2,2-5H3;2H,1H2,(H2,4,5);1H3,(H,2,3,4)/q+1;;/p-1.
What are the key properties of methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium?
methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium has a molecular weight of 354.43 g/mol, XLogP of -0.44, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl sulfate;prop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium is sourced from PubChem (CID 19005305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).