About 5-methyl-2-propyl-4,5-dihydro-1H-imidazole
5-methyl-2-propyl-4,5-dihydro-1H-imidazole (PubChem CID 19005749) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 5-methyl-2-propyl-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 5-methyl-2-propyl-4,5-dihydro-1H-imidazole |
| PubChem CID | 19005749 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 5-methyl-2-propyl-4,5-dihydro-1H-imidazole |
| SMILES | CCCC1=NCC(C)N1 |
| InChI | InChI=1S/C7H14N2/c1-3-4-7-8-5-6(2)9-7/h6H,3-5H2,1-2H3,(H,8,9) |
| InChIKey | OMASQTPPWRGJHV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-2-propyl-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-propyl-4,5-dihydro-1H-imidazole?
The IUPAC name of 5-methyl-2-propyl-4,5-dihydro-1H-imidazole (CID 19005749) is 5-methyl-2-propyl-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 5-methyl-2-propyl-4,5-dihydro-1H-imidazole?
The canonical SMILES for 5-methyl-2-propyl-4,5-dihydro-1H-imidazole is CCCC1=NCC(C)N1.
What is the InChIKey of 5-methyl-2-propyl-4,5-dihydro-1H-imidazole?
The InChIKey is OMASQTPPWRGJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-4-7-8-5-6(2)9-7/h6H,3-5H2,1-2H3,(H,8,9).
What are the key properties of 5-methyl-2-propyl-4,5-dihydro-1H-imidazole?
5-methyl-2-propyl-4,5-dihydro-1H-imidazole has a molecular weight of 126.20 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-propyl-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 19005749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).