C17H12O6 — CID 19005758
1,3'-spirobi[indene]-1',2',4',5',6',7'-hexol (PubChem CID 19005758) has the molecular formula C17H12O6 and a molecular weight of 312.28 g/mol. Its IUPAC name is 1,3'-spirobi[indene]-1',2',4',5',6',7'-hexol.
| Compound Name | 1,3'-spirobi[indene]-1',2',4',5',6',7'-hexol |
|---|---|
| PubChem CID | 19005758 |
| Molecular Formula | C17H12O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1,3'-spirobi[indene]-1',2',4',5',6',7'-hexol |
| SMILES | OC1=C(O)C2(C=Cc3ccccc32)c2c(O)c(O)c(O)c(O)c21 |
| InChI | InChI=1S/C17H12O6/c18-11-9-10(13(20)15(22)14(11)21)17(16(23)12(9)19)6-5-7-3-1-2-4-8(7)17/h1-6,18-23H |
| InChIKey | TUHFWSZXPCGHIU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|