About 3-methyl-2H-1,3-thiazole-2-thiol
3-methyl-2H-1,3-thiazole-2-thiol (PubChem CID 19005810) has the molecular formula C4H7NS2
and a molecular weight of 133.24 g/mol. Its IUPAC name is 3-methyl-2H-1,3-thiazole-2-thiol.
Molecular Properties
| Compound Name | 3-methyl-2H-1,3-thiazole-2-thiol |
| PubChem CID | 19005810 |
| Molecular Formula | C4H7NS2 |
| Molecular Weight | 133.24 g/mol |
| Exact Mass | 133.00 |
| IUPAC Name | 3-methyl-2H-1,3-thiazole-2-thiol |
| SMILES | CN1C=CSC1S |
| InChI | InChI=1S/C4H7NS2/c1-5-2-3-7-4(5)6/h2-4,6H,1H3 |
| InChIKey | FBCUAVRDSLTFMF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2H-1,3-thiazole-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2H-1,3-thiazole-2-thiol?
The IUPAC name of 3-methyl-2H-1,3-thiazole-2-thiol (CID 19005810) is 3-methyl-2H-1,3-thiazole-2-thiol.
What is the SMILES notation for 3-methyl-2H-1,3-thiazole-2-thiol?
The canonical SMILES for 3-methyl-2H-1,3-thiazole-2-thiol is CN1C=CSC1S.
What is the InChIKey of 3-methyl-2H-1,3-thiazole-2-thiol?
The InChIKey is FBCUAVRDSLTFMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NS2/c1-5-2-3-7-4(5)6/h2-4,6H,1H3.
What are the key properties of 3-methyl-2H-1,3-thiazole-2-thiol?
3-methyl-2H-1,3-thiazole-2-thiol has a molecular weight of 133.24 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2H-1,3-thiazole-2-thiol is sourced from PubChem (CID 19005810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).