About 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride
1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride (PubChem CID 19005994) has the molecular formula C6H11ClN4
and a molecular weight of 174.63 g/mol. Its IUPAC name is 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride.
Molecular Properties
| Compound Name | 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride |
| PubChem CID | 19005994 |
| Molecular Formula | C6H11ClN4 |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride |
| SMILES | Cl.c1ncn(C2CCNC2)n1 |
| InChI | InChI=1S/C6H10N4.ClH/c1-2-7-3-6(1)10-5-8-4-9-10;/h4-7H,1-3H2;1H |
| InChIKey | PASOUXNWUCOTSU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride?
The IUPAC name of 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride (CID 19005994) is 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride.
What is the SMILES notation for 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride?
The canonical SMILES for 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride is Cl.c1ncn(C2CCNC2)n1.
What is the InChIKey of 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride?
The InChIKey is PASOUXNWUCOTSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4.ClH/c1-2-7-3-6(1)10-5-8-4-9-10;/h4-7H,1-3H2;1H.
What are the key properties of 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride?
1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride has a molecular weight of 174.63 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-3-yl-1,2,4-triazole;hydrochloride is sourced from PubChem (CID 19005994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).