About 1-pyrrolidin-3-yl-1,2,4-triazole
1-pyrrolidin-3-yl-1,2,4-triazole (PubChem CID 19005995) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-pyrrolidin-3-yl-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-pyrrolidin-3-yl-1,2,4-triazole |
| PubChem CID | 19005995 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 1-pyrrolidin-3-yl-1,2,4-triazole |
| SMILES | c1ncn(C2CCNC2)n1 |
| InChI | InChI=1S/C6H10N4/c1-2-7-3-6(1)10-5-8-4-9-10/h4-7H,1-3H2 |
| InChIKey | ZTTBKRUMCUODGW-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrrolidin-3-yl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-3-yl-1,2,4-triazole?
The IUPAC name of 1-pyrrolidin-3-yl-1,2,4-triazole (CID 19005995) is 1-pyrrolidin-3-yl-1,2,4-triazole.
What is the SMILES notation for 1-pyrrolidin-3-yl-1,2,4-triazole?
The canonical SMILES for 1-pyrrolidin-3-yl-1,2,4-triazole is c1ncn(C2CCNC2)n1.
What is the InChIKey of 1-pyrrolidin-3-yl-1,2,4-triazole?
The InChIKey is ZTTBKRUMCUODGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-2-7-3-6(1)10-5-8-4-9-10/h4-7H,1-3H2.
What are the key properties of 1-pyrrolidin-3-yl-1,2,4-triazole?
1-pyrrolidin-3-yl-1,2,4-triazole has a molecular weight of 138.17 g/mol, XLogP of -0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-3-yl-1,2,4-triazole is sourced from PubChem (CID 19005995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).