C26H8Cl8N2O4 — CID 19006327
4,5,6,7-tetrachloro-2-[2-(4,5,6,7-tetrachloro-1-hydroxy-3-oxo-1,2-dihydroinden-2-yl)quinolin-8-yl]isoindole-1,3-dione (PubChem CID 19006327) has the molecular formula C26H8Cl8N2O4 and a molecular weight of 695.98 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[2-(4,5,6,7-tetrachloro-1-hydroxy-3-oxo-1,2-dihydroinden-2-yl)quinolin-8-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[2-(4,5,6,7-tetrachloro-1-hydroxy-3-oxo-1,2-dihydroinden-2-yl)quinolin-8-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19006327 |
| Molecular Formula | C26H8Cl8N2O4 |
| Molecular Weight | 695.98 g/mol |
| Exact Mass | 691.80 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[2-(4,5,6,7-tetrachloro-1-hydroxy-3-oxo-1,2-dihydroinden-2-yl)quinolin-8-yl]isoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(O)C1c1ccc2cccc(N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)c2n1 |
| InChI | InChI=1S/C26H8Cl8N2O4/c27-14-10-11(15(28)19(32)18(14)31)24(38)9(23(10)37)7-5-4-6-2-1-3-8(22(6)35-7)36-25(39)12-13(26(36)40)17(30)21(34)20(33)16(12)29/h1-5,9,23,37H |
| InChIKey | NVRBNQGKVJDISL-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.98 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|