C35H34F6O6S2 — CID 19006644
[4-[2-[4-(4-tert-butylphenyl)sulfonyloxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-tert-butylbenzenesulfonate (PubChem CID 19006644) has the molecular formula C35H34F6O6S2 and a molecular weight of 728.77 g/mol. Its IUPAC name is [4-[2-[4-(4-tert-butylphenyl)sulfonyloxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-tert-butylbenzenesulfonate.
| Compound Name | [4-[2-[4-(4-tert-butylphenyl)sulfonyloxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-tert-butylbenzenesulfonate |
|---|---|
| PubChem CID | 19006644 |
| Molecular Formula | C35H34F6O6S2 |
| Molecular Weight | 728.77 g/mol |
| Exact Mass | 728.17 |
| IUPAC Name | [4-[2-[4-(4-tert-butylphenyl)sulfonyloxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl] 4-tert-butylbenzenesulfonate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Oc2ccc(C(c3ccc(OS(=O)(=O)c4ccc(C(C)(C)C)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C35H34F6O6S2/c1-31(2,3)23-11-19-29(20-12-23)48(42,43)46-27-15-7-25(8-16-27)33(34(36,37)38,35(39,40)41)26-9-17-28(18-10-26)47-49(44,45)30-21-13-24(14-22-30)32(4,5)6/h7-22H,1-6H3 |
| InChIKey | WCBKBSLRHVAVES-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.77 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|