About 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole
6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole (PubChem CID 19006768) has the molecular formula C14H8BrIN2S2
and a molecular weight of 475.17 g/mol. Its IUPAC name is 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole |
| PubChem CID | 19006768 |
| Molecular Formula | C14H8BrIN2S2 |
| Molecular Weight | 475.17 g/mol |
| Exact Mass | 473.84 |
| IUPAC Name | 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole |
| SMILES | Brc1ccc2ncsc2c1.Ic1ccc2scnc2c1 |
| InChI | InChI=1S/C7H4BrNS.C7H4INS/c8-5-1-2-6-7(3-5)10-4-9-6;8-5-1-2-7-6(3-5)9-4-10-7/h2*1-4H |
| InChIKey | BJUUXZVTUMXCSP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.17 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole?
The IUPAC name of 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole (CID 19006768) is 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole.
What is the SMILES notation for 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole?
The canonical SMILES for 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole is Brc1ccc2ncsc2c1.Ic1ccc2scnc2c1.
What is the InChIKey of 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole?
The InChIKey is BJUUXZVTUMXCSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrNS.C7H4INS/c8-5-1-2-6-7(3-5)10-4-9-6;8-5-1-2-7-6(3-5)9-4-10-7/h2*1-4H.
What are the key properties of 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole?
6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole has a molecular weight of 475.17 g/mol, XLogP of 5.96, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,3-benzothiazole;5-iodo-1,3-benzothiazole is sourced from PubChem (CID 19006768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).