C22H26N2O7 — CID 19007317
2,3-dihydroxybutanedioic acid;2,2-diphenyl-2-pyrrolidin-3-ylacetamide (PubChem CID 19007317) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;2,2-diphenyl-2-pyrrolidin-3-ylacetamide.
| Compound Name | 2,3-dihydroxybutanedioic acid;2,2-diphenyl-2-pyrrolidin-3-ylacetamide |
|---|---|
| PubChem CID | 19007317 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;2,2-diphenyl-2-pyrrolidin-3-ylacetamide |
| SMILES | NC(=O)C(c1ccccc1)(c1ccccc1)C1CCNC1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C18H20N2O.C4H6O6/c19-17(21)18(16-11-12-20-13-16,14-7-3-1-4-8-14)15-9-5-2-6-10-15;5-1(3(7)8)2(6)4(9)10/h1-10,16,20H,11-13H2,(H2,19,21);1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | HRXFENQYWZZQMX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |