About 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride
4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride (PubChem CID 19007357) has the molecular formula C10H34BrClN2O12S
and a molecular weight of 521.81 g/mol. Its IUPAC name is 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride.
Molecular Properties
| Compound Name | 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride |
| PubChem CID | 19007357 |
| Molecular Formula | C10H34BrClN2O12S |
| Molecular Weight | 521.81 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride |
| SMILES | Cl.O.O.O.O.O.O.O.O.O.O.O.O.[H]/N=C(\N)c1cc2c(Br)c(C)ccc2s1 |
| InChI | InChI=1S/C10H9BrN2S.ClH.12H2O/c1-5-2-3-7-6(9(5)11)4-8(14-7)10(12)13;;;;;;;;;;;;;/h2-4H,1H3,(H3,12,13);1H;12*1H2 |
| InChIKey | YBWSYSVDFZZRJY-UHFFFAOYSA-N |
| XLogP | -6.22 |
| TPSA | 427.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 521.81 |
| LogP ≤ 5 | -6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride?
The IUPAC name of 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride (CID 19007357) is 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride.
What is the SMILES notation for 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride?
The canonical SMILES for 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride is Cl.O.O.O.O.O.O.O.O.O.O.O.O.[H]/N=C(\N)c1cc2c(Br)c(C)ccc2s1.
What is the InChIKey of 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride?
The InChIKey is YBWSYSVDFZZRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2S.ClH.12H2O/c1-5-2-3-7-6(9(5)11)4-8(14-7)10(12)13;;;;;;;;;;;;;/h2-4H,1H3,(H3,12,13);1H;12*1H2.
What are the key properties of 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride?
4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride has a molecular weight of 521.81 g/mol, XLogP of -6.22, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-methyl-1-benzothiophene-2-carboximidamide;dodecahydrate;hydrochloride is sourced from PubChem (CID 19007357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).