About 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride
4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride (PubChem CID 19007611) has the molecular formula C9H14Cl2N2O3S
and a molecular weight of 301.19 g/mol. Its IUPAC name is 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride |
| PubChem CID | 19007611 |
| Molecular Formula | C9H14Cl2N2O3S |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride |
| SMILES | Cl.O.O.O.[H]/N=C(\N)c1cc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C9H7ClN2S.ClH.3H2O/c10-6-2-1-3-7-5(6)4-8(13-7)9(11)12;;;;/h1-4H,(H3,11,12);1H;3*1H2 |
| InChIKey | PEOJJHPPGZDSLN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 144.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride?
The IUPAC name of 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride (CID 19007611) is 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride.
What is the SMILES notation for 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride?
The canonical SMILES for 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride is Cl.O.O.O.[H]/N=C(\N)c1cc2c(Cl)cccc2s1.
What is the InChIKey of 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride?
The InChIKey is PEOJJHPPGZDSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2S.ClH.3H2O/c10-6-2-1-3-7-5(6)4-8(13-7)9(11)12;;;;/h1-4H,(H3,11,12);1H;3*1H2.
What are the key properties of 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride?
4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride has a molecular weight of 301.19 g/mol, XLogP of 0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-benzothiophene-2-carboximidamide;trihydrate;hydrochloride is sourced from PubChem (CID 19007611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).