C12H14N2S — CID 19007628
4-propyl-1-benzothiophene-2-carboximidamide (PubChem CID 19007628) has the molecular formula C12H14N2S and a molecular weight of 218.33 g/mol. Its IUPAC name is 4-propyl-1-benzothiophene-2-carboximidamide.
| Compound Name | 4-propyl-1-benzothiophene-2-carboximidamide |
|---|---|
| PubChem CID | 19007628 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-propyl-1-benzothiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc2c(CCC)cccc2s1 |
| InChI | InChI=1S/C12H14N2S/c1-2-4-8-5-3-6-10-9(8)7-11(15-10)12(13)14/h3,5-7H,2,4H2,1H3,(H3,13,14) |
| InChIKey | DABPGZYSYOEZSH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|