About 2-(difluoromethyl)-2,3-dihydrofuran
2-(difluoromethyl)-2,3-dihydrofuran (PubChem CID 19007741) has the molecular formula C5H6F2O
and a molecular weight of 120.10 g/mol. Its IUPAC name is 2-(difluoromethyl)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-2,3-dihydrofuran |
| PubChem CID | 19007741 |
| Molecular Formula | C5H6F2O |
| Molecular Weight | 120.10 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 2-(difluoromethyl)-2,3-dihydrofuran |
| SMILES | FC(F)C1CC=CO1 |
| InChI | InChI=1S/C5H6F2O/c6-5(7)4-2-1-3-8-4/h1,3-5H,2H2 |
| InChIKey | GLIPKNZRCXZQLX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.10 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(difluoromethyl)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-2,3-dihydrofuran?
The IUPAC name of 2-(difluoromethyl)-2,3-dihydrofuran (CID 19007741) is 2-(difluoromethyl)-2,3-dihydrofuran.
What is the SMILES notation for 2-(difluoromethyl)-2,3-dihydrofuran?
The canonical SMILES for 2-(difluoromethyl)-2,3-dihydrofuran is FC(F)C1CC=CO1.
What is the InChIKey of 2-(difluoromethyl)-2,3-dihydrofuran?
The InChIKey is GLIPKNZRCXZQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F2O/c6-5(7)4-2-1-3-8-4/h1,3-5H,2H2.
What are the key properties of 2-(difluoromethyl)-2,3-dihydrofuran?
2-(difluoromethyl)-2,3-dihydrofuran has a molecular weight of 120.10 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-2,3-dihydrofuran is sourced from PubChem (CID 19007741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).