About 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride
3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride (PubChem CID 19007883) has the molecular formula C15H21ClN2O2
and a molecular weight of 296.80 g/mol. Its IUPAC name is 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride |
| PubChem CID | 19007883 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride |
| SMILES | CN1C2CCC1CC(c1noc3ccccc13)C2.Cl.O |
| InChI | InChI=1S/C15H18N2O.ClH.H2O/c1-17-11-6-7-12(17)9-10(8-11)15-13-4-2-3-5-14(13)18-16-15;;/h2-5,10-12H,6-9H2,1H3;1H;1H2 |
| InChIKey | VVEJCYNZIQKTDR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride?
The IUPAC name of 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride (CID 19007883) is 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride.
What is the SMILES notation for 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride?
The canonical SMILES for 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride is CN1C2CCC1CC(c1noc3ccccc13)C2.Cl.O.
What is the InChIKey of 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride?
The InChIKey is VVEJCYNZIQKTDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O.ClH.H2O/c1-17-11-6-7-12(17)9-10(8-11)15-13-4-2-3-5-14(13)18-16-15;;/h2-5,10-12H,6-9H2,1H3;1H;1H2.
What are the key properties of 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride?
3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride has a molecular weight of 296.80 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,2-benzoxazole;hydrate;hydrochloride is sourced from PubChem (CID 19007883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).