C31H48N2O2 — CID 19008091
5-butoxy-2-[2-methyl-4-[(4-nonylcyclohexyl)methoxy]phenyl]pyrimidine (PubChem CID 19008091) has the molecular formula C31H48N2O2 and a molecular weight of 480.74 g/mol. Its IUPAC name is 5-butoxy-2-[2-methyl-4-[(4-nonylcyclohexyl)methoxy]phenyl]pyrimidine.
| Compound Name | 5-butoxy-2-[2-methyl-4-[(4-nonylcyclohexyl)methoxy]phenyl]pyrimidine |
|---|---|
| PubChem CID | 19008091 |
| Molecular Formula | C31H48N2O2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.37 |
| IUPAC Name | 5-butoxy-2-[2-methyl-4-[(4-nonylcyclohexyl)methoxy]phenyl]pyrimidine |
| SMILES | CCCCCCCCCC1CCC(COc2ccc(-c3ncc(OCCCC)cn3)c(C)c2)CC1 |
| InChI | InChI=1S/C31H48N2O2/c1-4-6-8-9-10-11-12-13-26-14-16-27(17-15-26)24-35-28-18-19-30(25(3)21-28)31-32-22-29(23-33-31)34-20-7-5-2/h18-19,21-23,26-27H,4-17,20,24H2,1-3H3 |
| InChIKey | MRWSLRFUBBZURR-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|