C27H39ClN2O — CID 19008168
5-(2-chloro-4-pentylphenyl)-2-[(4-pentylcyclohexyl)methoxy]pyrimidine (PubChem CID 19008168) has the molecular formula C27H39ClN2O and a molecular weight of 443.08 g/mol. Its IUPAC name is 5-(2-chloro-4-pentylphenyl)-2-[(4-pentylcyclohexyl)methoxy]pyrimidine.
| Compound Name | 5-(2-chloro-4-pentylphenyl)-2-[(4-pentylcyclohexyl)methoxy]pyrimidine |
|---|---|
| PubChem CID | 19008168 |
| Molecular Formula | C27H39ClN2O |
| Molecular Weight | 443.08 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 5-(2-chloro-4-pentylphenyl)-2-[(4-pentylcyclohexyl)methoxy]pyrimidine |
| SMILES | CCCCCc1ccc(-c2cnc(OCC3CCC(CCCCC)CC3)nc2)c(Cl)c1 |
| InChI | InChI=1S/C27H39ClN2O/c1-3-5-7-9-21-11-13-23(14-12-21)20-31-27-29-18-24(19-30-27)25-16-15-22(17-26(25)28)10-8-6-4-2/h15-19,21,23H,3-14,20H2,1-2H3 |
| InChIKey | AALGMFIGFNECAH-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.08 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|