C22H37N — CID 19008174
N-butyl-2-methyl-4-(4-pentylcyclohexyl)aniline (PubChem CID 19008174) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is N-butyl-2-methyl-4-(4-pentylcyclohexyl)aniline.
| Compound Name | N-butyl-2-methyl-4-(4-pentylcyclohexyl)aniline |
|---|---|
| PubChem CID | 19008174 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | N-butyl-2-methyl-4-(4-pentylcyclohexyl)aniline |
| SMILES | CCCCCC1CCC(c2ccc(NCCCC)c(C)c2)CC1 |
| InChI | InChI=1S/C22H37N/c1-4-6-8-9-19-10-12-20(13-11-19)21-14-15-22(18(3)17-21)23-16-7-5-2/h14-15,17,19-20,23H,4-13,16H2,1-3H3 |
| InChIKey | KFUPZLKEZFHGFH-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|