About 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine
2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine (PubChem CID 19008638) has the molecular formula C14H27N3O4S
and a molecular weight of 333.45 g/mol. Its IUPAC name is 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine.
Molecular Properties
| Compound Name | 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine |
| PubChem CID | 19008638 |
| Molecular Formula | C14H27N3O4S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine |
| SMILES | CC(N=S(=O)=O)(C(=O)O)C1CCCCC1.CN1CCNCC1 |
| InChI | InChI=1S/C9H15NO4S.C5H12N2/c1-9(8(11)12,10-15(13)14)7-5-3-2-4-6-7;1-7-4-2-6-3-5-7/h7H,2-6H2,1H3,(H,11,12);6H,2-5H2,1H3 |
| InChIKey | DLINVGCXLQYOEG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine?
The IUPAC name of 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine (CID 19008638) is 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine.
What is the SMILES notation for 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine?
The canonical SMILES for 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine is CC(N=S(=O)=O)(C(=O)O)C1CCCCC1.CN1CCNCC1.
What is the InChIKey of 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine?
The InChIKey is DLINVGCXLQYOEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4S.C5H12N2/c1-9(8(11)12,10-15(13)14)7-5-3-2-4-6-7;1-7-4-2-6-3-5-7/h7H,2-6H2,1H3,(H,11,12);6H,2-5H2,1H3.
What are the key properties of 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine?
2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine has a molecular weight of 333.45 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-(sulfonylamino)propanoic acid;1-methylpiperazine is sourced from PubChem (CID 19008638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).