C21H16F5N3O2 — CID 19009711
2-[4-[[[2-methyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]amino]methyl]phenyl]benzoic acid (PubChem CID 19009711) has the molecular formula C21H16F5N3O2 and a molecular weight of 437.37 g/mol. Its IUPAC name is 2-[4-[[[2-methyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]amino]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[[2-methyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19009711 |
| Molecular Formula | C21H16F5N3O2 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-[4-[[[2-methyl-6-(1,1,2,2,2-pentafluoroethyl)pyrimidin-4-yl]amino]methyl]phenyl]benzoic acid |
| SMILES | Cc1nc(NCc2ccc(-c3ccccc3C(=O)O)cc2)cc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C21H16F5N3O2/c1-12-28-17(20(22,23)21(24,25)26)10-18(29-12)27-11-13-6-8-14(9-7-13)15-4-2-3-5-16(15)19(30)31/h2-10H,11H2,1H3,(H,30,31)(H,27,28,29) |
| InChIKey | VKWXQGZMTHBHIY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|