About 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride
2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride (PubChem CID 19010111) has the molecular formula C8H19ClN2O4
and a molecular weight of 242.70 g/mol. Its IUPAC name is 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride |
| PubChem CID | 19010111 |
| Molecular Formula | C8H19ClN2O4 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride |
| SMILES | CC(C)(C)NCC(CO)(CO)[N+](=O)[O-].Cl |
| InChI | InChI=1S/C8H18N2O4.ClH/c1-7(2,3)9-4-8(5-11,6-12)10(13)14;/h9,11-12H,4-6H2,1-3H3;1H |
| InChIKey | IUFYWLRYZFDCJO-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride?
The IUPAC name of 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride (CID 19010111) is 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride.
What is the SMILES notation for 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride?
The canonical SMILES for 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride is CC(C)(C)NCC(CO)(CO)[N+](=O)[O-].Cl.
What is the InChIKey of 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride?
The InChIKey is IUFYWLRYZFDCJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O4.ClH/c1-7(2,3)9-4-8(5-11,6-12)10(13)14;/h9,11-12H,4-6H2,1-3H3;1H.
What are the key properties of 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride?
2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride has a molecular weight of 242.70 g/mol, XLogP of -0.20, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(tert-butylamino)methyl]-2-nitropropane-1,3-diol;hydrochloride is sourced from PubChem (CID 19010111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).