C12H6F17NO — CID 19010662
N-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-methylprop-2-enamide (PubChem CID 19010662) has the molecular formula C12H6F17NO and a molecular weight of 503.15 g/mol. Its IUPAC name is N-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-methylprop-2-enamide.
| Compound Name | N-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 19010662 |
| Molecular Formula | C12H6F17NO |
| Molecular Weight | 503.15 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | N-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F17NO/c1-3(2)4(31)30-12(28,29)10(23,24)8(19,20)6(15,16)5(13,14)7(17,18)9(21,22)11(25,26)27/h1H2,2H3,(H,30,31) |
| InChIKey | YDCGEPOKRPJUDC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.15 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|