thiane-2-carboxylic acid

C6H10O2S — CID 19010944

IUPACthiane-2-carboxylic acid
SMILESO=C(O)C1CCCCS1
InChIInChI=1S/C6H10O2S/c7-6(8)5-3-1-2-4-9-5/h5H,1-4H2,(H,7,8)
InChIKeyONPZMTBFHFTVIN-UHFFFAOYSA-N
MW146.21 g/mol
LogP1.36
Rot. Bonds1

About thiane-2-carboxylic acid

thiane-2-carboxylic acid (PubChem CID 19010944) has the molecular formula C6H10O2S and a molecular weight of 146.21 g/mol. Its IUPAC name is thiane-2-carboxylic acid.

Molecular Properties

Compound Namethiane-2-carboxylic acid
PubChem CID19010944
Molecular FormulaC6H10O2S
Molecular Weight146.21 g/mol
Exact Mass146.04
IUPAC Namethiane-2-carboxylic acid
SMILESO=C(O)C1CCCCS1
InChIInChI=1S/C6H10O2S/c7-6(8)5-3-1-2-4-9-5/h5H,1-4H2,(H,7,8)
InChIKeyONPZMTBFHFTVIN-UHFFFAOYSA-N
XLogP1.36
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.21
LogP ≤ 51.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze thiane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of thiane-2-carboxylic acid?
The IUPAC name of thiane-2-carboxylic acid (CID 19010944) is thiane-2-carboxylic acid.
What is the SMILES notation for thiane-2-carboxylic acid?
The canonical SMILES for thiane-2-carboxylic acid is O=C(O)C1CCCCS1.
What is the InChIKey of thiane-2-carboxylic acid?
The InChIKey is ONPZMTBFHFTVIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c7-6(8)5-3-1-2-4-9-5/h5H,1-4H2,(H,7,8).
What are the key properties of thiane-2-carboxylic acid?
thiane-2-carboxylic acid has a molecular weight of 146.21 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiane-2-carboxylic acid is sourced from PubChem (CID 19010944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).