About thiane-3-carboxylic acid
thiane-3-carboxylic acid (PubChem CID 19010951) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is thiane-3-carboxylic acid.
Molecular Properties
| Compound Name | thiane-3-carboxylic acid |
| PubChem CID | 19010951 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | thiane-3-carboxylic acid |
| SMILES | O=C(O)C1CCCSC1 |
| InChI | InChI=1S/C6H10O2S/c7-6(8)5-2-1-3-9-4-5/h5H,1-4H2,(H,7,8) |
| InChIKey | DCMOTEAFHXHTAL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thiane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiane-3-carboxylic acid?
The IUPAC name of thiane-3-carboxylic acid (CID 19010951) is thiane-3-carboxylic acid.
What is the SMILES notation for thiane-3-carboxylic acid?
The canonical SMILES for thiane-3-carboxylic acid is O=C(O)C1CCCSC1.
What is the InChIKey of thiane-3-carboxylic acid?
The InChIKey is DCMOTEAFHXHTAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c7-6(8)5-2-1-3-9-4-5/h5H,1-4H2,(H,7,8).
What are the key properties of thiane-3-carboxylic acid?
thiane-3-carboxylic acid has a molecular weight of 146.21 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiane-3-carboxylic acid is sourced from PubChem (CID 19010951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).