About 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal
3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal (PubChem CID 19010974) has the molecular formula C12H20O5
and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal.
Molecular Properties
| Compound Name | 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal |
| PubChem CID | 19010974 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal |
| SMILES | C=CC1OC(C)(C)OC1C(CC=O)OCOC |
| InChI | InChI=1S/C12H20O5/c1-5-9-11(17-12(2,3)16-9)10(6-7-13)15-8-14-4/h5,7,9-11H,1,6,8H2,2-4H3 |
| InChIKey | RAZAFXKNZDKNBE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal?
The IUPAC name of 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal (CID 19010974) is 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal.
What is the SMILES notation for 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal?
The canonical SMILES for 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal is C=CC1OC(C)(C)OC1C(CC=O)OCOC.
What is the InChIKey of 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal?
The InChIKey is RAZAFXKNZDKNBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O5/c1-5-9-11(17-12(2,3)16-9)10(6-7-13)15-8-14-4/h5,7,9-11H,1,6,8H2,2-4H3.
What are the key properties of 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal?
3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal has a molecular weight of 244.29 g/mol, XLogP of 1.27, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-3-(methoxymethoxy)propanal is sourced from PubChem (CID 19010974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).