About [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate
[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate (PubChem CID 19010980) has the molecular formula C21H42O6Si2
and a molecular weight of 446.73 g/mol. Its IUPAC name is [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate.
Molecular Properties
| Compound Name | [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate |
| PubChem CID | 19010980 |
| Molecular Formula | C21H42O6Si2 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate |
| SMILES | CC(=O)OC1C(O[Si](C)(C)C(C)(C)C)CC(=O)C(CO)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O6Si2/c1-14(23)25-19-17(26-28(8,9)20(2,3)4)12-16(24)15(13-22)18(19)27-29(10,11)21(5,6)7/h15,17-19,22H,12-13H2,1-11H3 |
| InChIKey | QYDSNLKXYCHQCS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate?
The IUPAC name of [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate (CID 19010980) is [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate.
What is the SMILES notation for [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate?
The canonical SMILES for [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate is CC(=O)OC1C(O[Si](C)(C)C(C)(C)C)CC(=O)C(CO)C1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate?
The InChIKey is QYDSNLKXYCHQCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O6Si2/c1-14(23)25-19-17(26-28(8,9)20(2,3)4)12-16(24)15(13-22)18(19)27-29(10,11)21(5,6)7/h15,17-19,22H,12-13H2,1-11H3.
What are the key properties of [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate?
[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate has a molecular weight of 446.73 g/mol, XLogP of 4.28, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(hydroxymethyl)-4-oxocyclohexyl] acetate is sourced from PubChem (CID 19010980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).