C18H31O10P — CID 19010988
3-[[7-(methoxymethoxy)-2,2-dimethyl-5-oxo-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-yl]methoxycarbonyl]pentan-3-ylphosphonic acid (PubChem CID 19010988) has the molecular formula C18H31O10P and a molecular weight of 438.41 g/mol. Its IUPAC name is 3-[[7-(methoxymethoxy)-2,2-dimethyl-5-oxo-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-yl]methoxycarbonyl]pentan-3-ylphosphonic acid.
| Compound Name | 3-[[7-(methoxymethoxy)-2,2-dimethyl-5-oxo-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-yl]methoxycarbonyl]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 19010988 |
| Molecular Formula | C18H31O10P |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[[7-(methoxymethoxy)-2,2-dimethyl-5-oxo-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-4-yl]methoxycarbonyl]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(C(=O)OCC1C(=O)CC(OCOC)C2OC(C)(C)OC12)P(=O)(O)O |
| InChI | InChI=1S/C18H31O10P/c1-6-18(7-2,29(21,22)23)16(20)25-9-11-12(19)8-13(26-10-24-5)15-14(11)27-17(3,4)28-15/h11,13-15H,6-10H2,1-5H3,(H2,21,22,23) |
| InChIKey | UXEZISCGTIODSF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|