2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid

C11H9NO5 — CID 19011133

IUPAC2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid
SMILESO=C(O)CC1OC(=O)N(c2ccccc2)C1=O
InChIInChI=1S/C11H9NO5/c13-9(14)6-8-10(15)12(11(16)17-8)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,13,14)
InChIKeyGBCZEGBMOZWOQO-UHFFFAOYSA-N
MW235.19 g/mol
LogP1.01
Rot. Bonds3

About 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid

2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid (PubChem CID 19011133) has the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. Its IUPAC name is 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid
PubChem CID19011133
Molecular FormulaC11H9NO5
Molecular Weight235.19 g/mol
Exact Mass235.05
IUPAC Name2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid
SMILESO=C(O)CC1OC(=O)N(c2ccccc2)C1=O
InChIInChI=1S/C11H9NO5/c13-9(14)6-8-10(15)12(11(16)17-8)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,13,14)
InChIKeyGBCZEGBMOZWOQO-UHFFFAOYSA-N
XLogP1.01
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.19
LogP ≤ 51.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid?
The IUPAC name of 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid (CID 19011133) is 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid.
What is the SMILES notation for 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid?
The canonical SMILES for 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid is O=C(O)CC1OC(=O)N(c2ccccc2)C1=O.
What is the InChIKey of 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid?
The InChIKey is GBCZEGBMOZWOQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO5/c13-9(14)6-8-10(15)12(11(16)17-8)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,13,14).
What are the key properties of 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid?
2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid has a molecular weight of 235.19 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-3-phenyl-1,3-oxazolidin-5-yl)acetic acid is sourced from PubChem (CID 19011133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).