About 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide
3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide (PubChem CID 19011348) has the molecular formula C17H25N5O2
and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide.
Molecular Properties
| Compound Name | 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide |
| PubChem CID | 19011348 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide |
| SMILES | CC(Cc1ccccc1)C(C)NC(=O)n1nc(N(C)C)n(C)c1=O |
| InChI | InChI=1S/C17H25N5O2/c1-12(11-14-9-7-6-8-10-14)13(2)18-16(23)22-17(24)21(5)15(19-22)20(3)4/h6-10,12-13H,11H2,1-5H3,(H,18,23) |
| InChIKey | DEMXPXRYAWOGOI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide?
The IUPAC name of 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide (CID 19011348) is 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide.
What is the SMILES notation for 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide?
The canonical SMILES for 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide is CC(Cc1ccccc1)C(C)NC(=O)n1nc(N(C)C)n(C)c1=O.
What is the InChIKey of 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide?
The InChIKey is DEMXPXRYAWOGOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5O2/c1-12(11-14-9-7-6-8-10-14)13(2)18-16(23)22-17(24)21(5)15(19-22)20(3)4/h6-10,12-13H,11H2,1-5H3,(H,18,23).
What are the key properties of 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide?
3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide has a molecular weight of 331.42 g/mol, XLogP of 1.47, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)-4-methyl-N-(3-methyl-4-phenylbutan-2-yl)-5-oxo-1,2,4-triazole-1-carboxamide is sourced from PubChem (CID 19011348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).