C20H28F2N4O3 — CID 19011962
6-[3-[3-(3,5-difluorophenyl)propyl-(2-hydroxyethyl)amino]propylamino]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 19011962) has the molecular formula C20H28F2N4O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 6-[3-[3-(3,5-difluorophenyl)propyl-(2-hydroxyethyl)amino]propylamino]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[3-[3-(3,5-difluorophenyl)propyl-(2-hydroxyethyl)amino]propylamino]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19011962 |
| Molecular Formula | C20H28F2N4O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 6-[3-[3-(3,5-difluorophenyl)propyl-(2-hydroxyethyl)amino]propylamino]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(NCCCN(CCO)CCCc2cc(F)cc(F)c2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C20H28F2N4O3/c1-24-18(14-19(28)25(2)20(24)29)23-6-4-8-26(9-10-27)7-3-5-15-11-16(21)13-17(22)12-15/h11-14,23,27H,3-10H2,1-2H3 |
| InChIKey | RKRMCIAWSXFALW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|