About (3Z,5Z)-1-benzazocine;hydrochloride
(3Z,5Z)-1-benzazocine;hydrochloride (PubChem CID 19012256) has the molecular formula C11H10ClN
and a molecular weight of 191.66 g/mol. Its IUPAC name is (3Z,5Z)-1-benzazocine;hydrochloride.
Molecular Properties
| Compound Name | (3Z,5Z)-1-benzazocine;hydrochloride |
| PubChem CID | 19012256 |
| Molecular Formula | C11H10ClN |
| Molecular Weight | 191.66 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | (3Z,5Z)-1-benzazocine;hydrochloride |
| SMILES | C1=C\C=N/c2ccccc2\C=C/1.Cl |
| InChI | InChI=1S/C11H9N.ClH/c1-2-6-10-7-3-4-8-11(10)12-9-5-1;/h1-9H;1H/b2-1-,5-1-,6-2-,9-5-,10-6-,12-9-,12-11-; |
| InChIKey | ATTYHEKHUXSBNN-JSDQSPIGSA-N |
| XLogP | 3.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3Z,5Z)-1-benzazocine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-1-benzazocine;hydrochloride?
The IUPAC name of (3Z,5Z)-1-benzazocine;hydrochloride (CID 19012256) is (3Z,5Z)-1-benzazocine;hydrochloride.
What is the SMILES notation for (3Z,5Z)-1-benzazocine;hydrochloride?
The canonical SMILES for (3Z,5Z)-1-benzazocine;hydrochloride is C1=C\C=N/c2ccccc2\C=C/1.Cl.
What is the InChIKey of (3Z,5Z)-1-benzazocine;hydrochloride?
The InChIKey is ATTYHEKHUXSBNN-JSDQSPIGSA-N. The full InChI is InChI=1S/C11H9N.ClH/c1-2-6-10-7-3-4-8-11(10)12-9-5-1;/h1-9H;1H/b2-1-,5-1-,6-2-,9-5-,10-6-,12-9-,12-11-;.
What are the key properties of (3Z,5Z)-1-benzazocine;hydrochloride?
(3Z,5Z)-1-benzazocine;hydrochloride has a molecular weight of 191.66 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-1-benzazocine;hydrochloride is sourced from PubChem (CID 19012256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).