About 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one
4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one (PubChem CID 19012664) has the molecular formula C12H10O2S
and a molecular weight of 218.28 g/mol. Its IUPAC name is 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one |
| PubChem CID | 19012664 |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC(SC2=CCC(=O)C=C2)=CC1 |
| InChI | InChI=1S/C12H10O2S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1,3,5-8H,2,4H2 |
| InChIKey | BJMIZMPGZPERKF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one?
The IUPAC name of 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one (CID 19012664) is 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one is O=C1C=CC(SC2=CCC(=O)C=C2)=CC1.
What is the InChIKey of 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one?
The InChIKey is BJMIZMPGZPERKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1,3,5-8H,2,4H2.
What are the key properties of 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one?
4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one has a molecular weight of 218.28 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-oxocyclohexa-1,5-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 19012664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).