C24H49N5 — CID 19012784
2,2,6,6-tetramethyl-N-[2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)piperazin-1-yl]ethyl]piperidin-4-amine (PubChem CID 19012784) has the molecular formula C24H49N5 and a molecular weight of 407.69 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-[2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)piperazin-1-yl]ethyl]piperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-[2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)piperazin-1-yl]ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 19012784 |
| Molecular Formula | C24H49N5 |
| Molecular Weight | 407.69 g/mol |
| Exact Mass | 407.40 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-[2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)piperazin-1-yl]ethyl]piperidin-4-amine |
| SMILES | CC1(C)CC(NCCN2CCN(C3CC(C)(C)NC(C)(C)C3)CC2)CC(C)(C)N1 |
| InChI | InChI=1S/C24H49N5/c1-21(2)15-19(16-22(3,4)26-21)25-9-10-28-11-13-29(14-12-28)20-17-23(5,6)27-24(7,8)18-20/h19-20,25-27H,9-18H2,1-8H3 |
| InChIKey | QAVYECBSWOYKCJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |