C15H16O — CID 19013076
(E,4Z)-4-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)but-2-enal (PubChem CID 19013076) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is (E,4Z)-4-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)but-2-enal.
| Compound Name | (E,4Z)-4-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)but-2-enal |
|---|---|
| PubChem CID | 19013076 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (E,4Z)-4-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylidene)but-2-enal |
| SMILES | O=C/C=C/C=C1/CCCCc2ccccc21 |
| InChI | InChI=1S/C15H16O/c16-12-6-5-10-14-8-2-1-7-13-9-3-4-11-15(13)14/h3-6,9-12H,1-2,7-8H2/b6-5+,14-10- |
| InChIKey | CRDKPEFBKPCTKL-WYCQDPOXSA-N |
| XLogP | 3.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|