About 5-ethenyl-1,3-dioxolane-4-carboxylic acid
5-ethenyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 19013854) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 5-ethenyl-1,3-dioxolane-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-ethenyl-1,3-dioxolane-4-carboxylic acid |
| PubChem CID | 19013854 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 5-ethenyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | C=CC1OCOC1C(=O)O |
| InChI | InChI=1S/C6H8O4/c1-2-4-5(6(7)8)10-3-9-4/h2,4-5H,1,3H2,(H,7,8) |
| InChIKey | BYYIWEGWZXBEDJ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-1,3-dioxolane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of 5-ethenyl-1,3-dioxolane-4-carboxylic acid (CID 19013854) is 5-ethenyl-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for 5-ethenyl-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for 5-ethenyl-1,3-dioxolane-4-carboxylic acid is C=CC1OCOC1C(=O)O.
What is the InChIKey of 5-ethenyl-1,3-dioxolane-4-carboxylic acid?
The InChIKey is BYYIWEGWZXBEDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c1-2-4-5(6(7)8)10-3-9-4/h2,4-5H,1,3H2,(H,7,8).
What are the key properties of 5-ethenyl-1,3-dioxolane-4-carboxylic acid?
5-ethenyl-1,3-dioxolane-4-carboxylic acid has a molecular weight of 144.13 g/mol, XLogP of -0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 19013854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).