C38H49FO4 — CID 19013928
[4-(1-fluorodecoxycarbonyl)phenyl] 4-(4-octylphenyl)benzoate (PubChem CID 19013928) has the molecular formula C38H49FO4 and a molecular weight of 588.80 g/mol. Its IUPAC name is [4-(1-fluorodecoxycarbonyl)phenyl] 4-(4-octylphenyl)benzoate.
| Compound Name | [4-(1-fluorodecoxycarbonyl)phenyl] 4-(4-octylphenyl)benzoate |
|---|---|
| PubChem CID | 19013928 |
| Molecular Formula | C38H49FO4 |
| Molecular Weight | 588.80 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | [4-(1-fluorodecoxycarbonyl)phenyl] 4-(4-octylphenyl)benzoate |
| SMILES | CCCCCCCCCC(F)OC(=O)c1ccc(OC(=O)c2ccc(-c3ccc(CCCCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H49FO4/c1-3-5-7-9-11-13-15-17-36(39)43-38(41)34-26-28-35(29-27-34)42-37(40)33-24-22-32(23-25-33)31-20-18-30(19-21-31)16-14-12-10-8-6-4-2/h18-29,36H,3-17H2,1-2H3 |
| InChIKey | ACQYGYIQEVDILG-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.80 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|