About 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine
4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine (PubChem CID 19014007) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 19014007 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine |
| SMILES | CCCN(CCC)C1=CCC(=[N+]=[N-])C=C1 |
| InChI | InChI=1S/C12H19N3/c1-3-9-15(10-4-2)12-7-5-11(14-13)6-8-12/h5,7-8H,3-4,6,9-10H2,1-2H3 |
| InChIKey | NFHQANYCNWIDTL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 39.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine (CID 19014007) is 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine is CCCN(CCC)C1=CCC(=[N+]=[N-])C=C1.
What is the InChIKey of 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine?
The InChIKey is NFHQANYCNWIDTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-3-9-15(10-4-2)12-7-5-11(14-13)6-8-12/h5,7-8H,3-4,6,9-10H2,1-2H3.
What are the key properties of 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine?
4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine has a molecular weight of 205.30 g/mol, XLogP of 2.62, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazo-N,N-dipropylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 19014007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).