C30H47IN2O3 — CID 19015364
2-(3-tert-butyl-4-decoxyphenoxy)-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]acetamide iodide (PubChem CID 19015364) has the molecular formula C30H47IN2O3 and a molecular weight of 610.62 g/mol. Its IUPAC name is 2-(3-tert-butyl-4-decoxyphenoxy)-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]acetamide iodide.
| Compound Name | 2-(3-tert-butyl-4-decoxyphenoxy)-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]acetamide iodide |
|---|---|
| PubChem CID | 19015364 |
| Molecular Formula | C30H47IN2O3 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | 2-(3-tert-butyl-4-decoxyphenoxy)-N-[2-(1-methylpyridin-1-ium-4-yl)ethyl]acetamide iodide |
| SMILES | CCCCCCCCCCOc1ccc(OCC(=O)NCCc2cc[n+](C)cc2)cc1C(C)(C)C.[I-] |
| InChI | InChI=1S/C30H46N2O3.HI/c1-6-7-8-9-10-11-12-13-22-34-28-15-14-26(23-27(28)30(2,3)4)35-24-29(33)31-19-16-25-17-20-32(5)21-18-25;/h14-15,17-18,20-21,23H,6-13,16,19,22,24H2,1-5H3;1H |
| InChIKey | CGMQKRACWGXHCN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|