C16H22F3N3O5S — CID 19016541
3-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-4-(6,6,6-trifluorohexoxy)-1,2,5-thiadiazole;oxalic acid (PubChem CID 19016541) has the molecular formula C16H22F3N3O5S and a molecular weight of 425.43 g/mol. Its IUPAC name is 3-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-4-(6,6,6-trifluorohexoxy)-1,2,5-thiadiazole;oxalic acid.
| Compound Name | 3-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-4-(6,6,6-trifluorohexoxy)-1,2,5-thiadiazole;oxalic acid |
|---|---|
| PubChem CID | 19016541 |
| Molecular Formula | C16H22F3N3O5S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 3-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-4-(6,6,6-trifluorohexoxy)-1,2,5-thiadiazole;oxalic acid |
| SMILES | CC1NCCC=C1c1nsnc1OCCCCCC(F)(F)F.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H20F3N3OS.C2H2O4/c1-10-11(6-5-8-18-10)12-13(20-22-19-12)21-9-4-2-3-7-14(15,16)17;3-1(4)2(5)6/h6,10,18H,2-5,7-9H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | BGVMCJCBEARUON-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|