C23H28N2O5 — CID 19016588
3-O-(2-methoxyethyl) 5-O-propan-2-yl 4-(4-cyanophenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 19016588) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-O-(2-methoxyethyl) 5-O-propan-2-yl 4-(4-cyanophenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | 3-O-(2-methoxyethyl) 5-O-propan-2-yl 4-(4-cyanophenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19016588 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 3-O-(2-methoxyethyl) 5-O-propan-2-yl 4-(4-cyanophenyl)-1,2,6-trimethyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | COCCOC(=O)C1=C(C)N(C)C(C)=C(C(=O)OC(C)C)C1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H28N2O5/c1-14(2)30-23(27)20-16(4)25(5)15(3)19(22(26)29-12-11-28-6)21(20)18-9-7-17(13-24)8-10-18/h7-10,14,21H,11-12H2,1-6H3 |
| InChIKey | JWDVTJAVBZXALQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|