About piperazine-1,2-dicarbaldehyde
piperazine-1,2-dicarbaldehyde (PubChem CID 19016607) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is piperazine-1,2-dicarbaldehyde.
Molecular Properties
| Compound Name | piperazine-1,2-dicarbaldehyde |
| PubChem CID | 19016607 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | piperazine-1,2-dicarbaldehyde |
| SMILES | O=CC1CNCCN1C=O |
| InChI | InChI=1S/C6H10N2O2/c9-4-6-3-7-1-2-8(6)5-10/h4-7H,1-3H2 |
| InChIKey | HIRJFVFSDAJYNR-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze piperazine-1,2-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-1,2-dicarbaldehyde?
The IUPAC name of piperazine-1,2-dicarbaldehyde (CID 19016607) is piperazine-1,2-dicarbaldehyde.
What is the SMILES notation for piperazine-1,2-dicarbaldehyde?
The canonical SMILES for piperazine-1,2-dicarbaldehyde is O=CC1CNCCN1C=O.
What is the InChIKey of piperazine-1,2-dicarbaldehyde?
The InChIKey is HIRJFVFSDAJYNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c9-4-6-3-7-1-2-8(6)5-10/h4-7H,1-3H2.
What are the key properties of piperazine-1,2-dicarbaldehyde?
piperazine-1,2-dicarbaldehyde has a molecular weight of 142.16 g/mol, XLogP of -1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1,2-dicarbaldehyde is sourced from PubChem (CID 19016607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).