C8H17N4+ — CID 19016682
5-butyl-1,4-dimethyl-1,2,4-triazol-4-ium-3-amine (PubChem CID 19016682) has the molecular formula C8H17N4+ and a molecular weight of 169.25 g/mol. Its IUPAC name is 5-butyl-1,4-dimethyl-1,2,4-triazol-4-ium-3-amine.
| Compound Name | 5-butyl-1,4-dimethyl-1,2,4-triazol-4-ium-3-amine |
|---|---|
| PubChem CID | 19016682 |
| Molecular Formula | C8H17N4+ |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.14 |
| IUPAC Name | 5-butyl-1,4-dimethyl-1,2,4-triazol-4-ium-3-amine |
| SMILES | CCCCc1n(C)nc(N)[n+]1C |
| InChI | InChI=1S/C8H17N4/c1-4-5-6-7-11(2)8(9)10-12(7)3/h4-6H2,1-3H3,(H2,9,10)/q+1 |
| InChIKey | PRUVFRYNXUQPQF-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|