C16H12O6P2S4 — CID 19017341
[2-(5-phosphono-3,4-dithiophen-2-ylthiophen-2-yl)thiophen-3-yl]phosphonic acid (PubChem CID 19017341) has the molecular formula C16H12O6P2S4 and a molecular weight of 490.48 g/mol. Its IUPAC name is [2-(5-phosphono-3,4-dithiophen-2-ylthiophen-2-yl)thiophen-3-yl]phosphonic acid.
| Compound Name | [2-(5-phosphono-3,4-dithiophen-2-ylthiophen-2-yl)thiophen-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 19017341 |
| Molecular Formula | C16H12O6P2S4 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 489.90 |
| IUPAC Name | [2-(5-phosphono-3,4-dithiophen-2-ylthiophen-2-yl)thiophen-3-yl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccsc1-c1sc(P(=O)(O)O)c(-c2cccs2)c1-c1cccs1 |
| InChI | InChI=1S/C16H12O6P2S4/c17-23(18,19)9-5-8-27-14(9)15-12(10-3-1-6-25-10)13(11-4-2-7-26-11)16(28-15)24(20,21)22/h1-8H,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | KTNZMHNFYMGMJO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|