About 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate
2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate (PubChem CID 19017389) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate |
| PubChem CID | 19017389 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate |
| SMILES | CC(=O)OCCC1CC=CC(=O)C1(C)C |
| InChI | InChI=1S/C12H18O3/c1-9(13)15-8-7-10-5-4-6-11(14)12(10,2)3/h4,6,10H,5,7-8H2,1-3H3 |
| InChIKey | NOMLHCNEZRDPPB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate?
The IUPAC name of 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate (CID 19017389) is 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate.
What is the SMILES notation for 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate?
The canonical SMILES for 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate is CC(=O)OCCC1CC=CC(=O)C1(C)C.
What is the InChIKey of 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate?
The InChIKey is NOMLHCNEZRDPPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-9(13)15-8-7-10-5-4-6-11(14)12(10,2)3/h4,6,10H,5,7-8H2,1-3H3.
What are the key properties of 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate?
2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate has a molecular weight of 210.27 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6-dimethyl-5-oxocyclohex-3-en-1-yl)ethyl acetate is sourced from PubChem (CID 19017389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).