C29H36N4O7 — CID 19017445
tert-butyl 2-[[1-(benzylamino)-4-methyl-1-oxopentan-2-yl]amino]-4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 19017445) has the molecular formula C29H36N4O7 and a molecular weight of 552.63 g/mol. Its IUPAC name is tert-butyl 2-[[1-(benzylamino)-4-methyl-1-oxopentan-2-yl]amino]-4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | tert-butyl 2-[[1-(benzylamino)-4-methyl-1-oxopentan-2-yl]amino]-4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 19017445 |
| Molecular Formula | C29H36N4O7 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | tert-butyl 2-[[1-(benzylamino)-4-methyl-1-oxopentan-2-yl]amino]-4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CC(C)CC(NC(CCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)C(=O)OC(C)(C)C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H36N4O7/c1-18(2)15-24(25(34)30-17-19-9-7-6-8-10-19)31-23(28(37)40-29(3,4)5)13-14-32-26(35)21-12-11-20(33(38)39)16-22(21)27(32)36/h6-12,16,18,23-24,31H,13-15,17H2,1-5H3,(H,30,34) |
| InChIKey | WYIQVQPFCGSDRB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|